About tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate
tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate (PubChem CID 59175705) has the molecular formula C23H27BrN4O4
and a molecular weight of 503.40 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate |
| PubChem CID | 59175705 |
| Molecular Formula | C23H27BrN4O4 |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCOc1ccccc1)CCn1ncn(-c2ccc(Br)cc2)c1=O |
| InChI | InChI=1S/C23H27BrN4O4/c1-23(2,3)32-22(30)26(15-16-31-20-7-5-4-6-8-20)13-14-28-21(29)27(17-25-28)19-11-9-18(24)10-12-19/h4-12,17H,13-16H2,1-3H3 |
| InChIKey | FKDSJZWZOHSXFZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate?
The IUPAC name of tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate (CID 59175705) is tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate.
What is the SMILES notation for tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate?
The canonical SMILES for tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate is CC(C)(C)OC(=O)N(CCOc1ccccc1)CCn1ncn(-c2ccc(Br)cc2)c1=O.
What is the InChIKey of tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate?
The InChIKey is FKDSJZWZOHSXFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27BrN4O4/c1-23(2,3)32-22(30)26(15-16-31-20-7-5-4-6-8-20)13-14-28-21(29)27(17-25-28)19-11-9-18(24)10-12-19/h4-12,17H,13-16H2,1-3H3.
What are the key properties of tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate?
tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate has a molecular weight of 503.40 g/mol, XLogP of 4.11, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[4-(4-bromophenyl)-5-oxo-1,2,4-triazol-1-yl]ethyl]-N-(2-phenoxyethyl)carbamate is sourced from PubChem (CID 59175705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).