C24H31N5O3 — CID 59175752
4-[4-[(oxolan-2-ylmethylamino)methyl]phenyl]-2-[2-(2-phenoxyethylamino)ethyl]-1,2,4-triazol-3-one (PubChem CID 59175752) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-[4-[(oxolan-2-ylmethylamino)methyl]phenyl]-2-[2-(2-phenoxyethylamino)ethyl]-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[(oxolan-2-ylmethylamino)methyl]phenyl]-2-[2-(2-phenoxyethylamino)ethyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 59175752 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 4-[4-[(oxolan-2-ylmethylamino)methyl]phenyl]-2-[2-(2-phenoxyethylamino)ethyl]-1,2,4-triazol-3-one |
| SMILES | O=c1n(-c2ccc(CNCC3CCCO3)cc2)cnn1CCNCCOc1ccccc1 |
| InChI | InChI=1S/C24H31N5O3/c30-24-28(21-10-8-20(9-11-21)17-26-18-23-7-4-15-31-23)19-27-29(24)14-12-25-13-16-32-22-5-2-1-3-6-22/h1-3,5-6,8-11,19,23,25-26H,4,7,12-18H2 |
| InChIKey | RYIXFLSGJWMABC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|