C27H23F7N4O3 — CID 59175860
N-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]pyridine-4-carboxamide (PubChem CID 59175860) has the molecular formula C27H23F7N4O3 and a molecular weight of 584.49 g/mol. Its IUPAC name is N-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 59175860 |
| Molecular Formula | C27H23F7N4O3 |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | N-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1F)c1ccncc1 |
| InChI | InChI=1S/C27H23F7N4O3/c28-21-15-19(3-6-22(21)36-23(39)18-7-9-35-10-8-18)24(40)38-13-11-37(12-14-38)16-17-1-4-20(5-2-17)25(41,26(29,30)31)27(32,33)34/h1-10,15,41H,11-14,16H2,(H,36,39) |
| InChIKey | DIKNRCFHDFJRCU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |