C26H23F7N6O3 — CID 59175890
1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-pyridazin-3-ylurea (PubChem CID 59175890) has the molecular formula C26H23F7N6O3 and a molecular weight of 600.50 g/mol. Its IUPAC name is 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-pyridazin-3-ylurea.
| Compound Name | 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-pyridazin-3-ylurea |
|---|---|
| PubChem CID | 59175890 |
| Molecular Formula | C26H23F7N6O3 |
| Molecular Weight | 600.50 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-pyridazin-3-ylurea |
| SMILES | O=C(Nc1cccnn1)Nc1ccc(C(=O)N2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1F |
| InChI | InChI=1S/C26H23F7N6O3/c27-19-14-17(5-8-20(19)35-23(41)36-21-2-1-9-34-37-21)22(40)39-12-10-38(11-13-39)15-16-3-6-18(7-4-16)24(42,25(28,29)30)26(31,32)33/h1-9,14,42H,10-13,15H2,(H2,35,36,37,41) |
| InChIKey | KLIVHOBOGDSUNF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |