About CID 59175956
CID 59175956 (PubChem CID 59175956) has the molecular formula C8H16N2O2S
and a molecular weight of 204.29 g/mol.
Molecular Properties
| Compound Name | CID 59175956 |
| PubChem CID | 59175956 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | — |
| SMILES | [CH]NS(=O)(=O)CCN(CC)C1CC1 |
| InChI | InChI=1S/C8H16N2O2S/c1-3-10(8-4-5-8)6-7-13(11,12)9-2/h2,8-9H,3-7H2,1H3 |
| InChIKey | GBSDZGWNYXQSFE-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze CID 59175956 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59175956?
The IUPAC name of CID 59175956 (CID 59175956) is not available.
What is the SMILES notation for CID 59175956?
The canonical SMILES for CID 59175956 is [CH]NS(=O)(=O)CCN(CC)C1CC1.
What is the InChIKey of CID 59175956?
The InChIKey is GBSDZGWNYXQSFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2S/c1-3-10(8-4-5-8)6-7-13(11,12)9-2/h2,8-9H,3-7H2,1H3.
What are the key properties of CID 59175956?
CID 59175956 has a molecular weight of 204.29 g/mol, XLogP of 0.06, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59175956 is sourced from PubChem (CID 59175956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).