About 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium
4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium (PubChem CID 59176019) has the molecular formula C20H20N3O5Y-
and a molecular weight of 471.30 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium |
| PubChem CID | 59176019 |
| Molecular Formula | C20H20N3O5Y- |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium |
| SMILES | Oc1cc2c(Nc3cccc4c3OCO4)ncnc2cc1OCC1CO1.[CH2-]C.[Y] |
| InChI | InChI=1S/C18H15N3O5.C2H5.Y/c22-14-4-11-13(5-16(14)24-7-10-6-23-10)19-8-20-18(11)21-12-2-1-3-15-17(12)26-9-25-15;1-2;/h1-5,8,10,22H,6-7,9H2,(H,19,20,21);1H2,2H3;/q;-1; |
| InChIKey | RIVVDILRZVLJNV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium?
The IUPAC name of 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium (CID 59176019) is 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium.
What is the SMILES notation for 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium?
The canonical SMILES for 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium is Oc1cc2c(Nc3cccc4c3OCO4)ncnc2cc1OCC1CO1.[CH2-]C.[Y].
What is the InChIKey of 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium?
The InChIKey is RIVVDILRZVLJNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O5.C2H5.Y/c22-14-4-11-13(5-16(14)24-7-10-6-23-10)19-8-20-18(11)21-12-2-1-3-15-17(12)26-9-25-15;1-2;/h1-5,8,10,22H,6-7,9H2,(H,19,20,21);1H2,2H3;/q;-1;.
What are the key properties of 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium?
4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium has a molecular weight of 471.30 g/mol, XLogP of 3.42, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-4-ylamino)-7-(oxiran-2-ylmethoxy)quinazolin-6-ol;ethane;yttrium is sourced from PubChem (CID 59176019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).