C32H46N2O5 — CID 59176213
3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-N,2,2-trimethylpropanamide (PubChem CID 59176213) has the molecular formula C32H46N2O5 and a molecular weight of 538.73 g/mol. Its IUPAC name is 3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 59176213 |
| Molecular Formula | C32H46N2O5 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | 3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)C[C@H]1CC[C@H](OCc2ccc3c(c2)N(CCCOC)CCO3)[C@@H](c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C32H46N2O5/c1-32(2,31(35)33-3)21-23-7-13-29(27(19-23)25-9-11-26(37-5)12-10-25)39-22-24-8-14-30-28(20-24)34(16-18-38-30)15-6-17-36-4/h8-12,14,20,23,27,29H,6-7,13,15-19,21-22H2,1-5H3,(H,33,35)/t23-,27+,29-/m0/s1 |
| InChIKey | QAIZUCDUPIWDSM-LCRMXPIESA-N |
| XLogP | 5.56 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|