C39H43N7O2 — CID 59176455
2-[3-[1-[[3-piperazin-1-ylpropyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]propyl]isoindole-1,3-dione (PubChem CID 59176455) has the molecular formula C39H43N7O2 and a molecular weight of 641.82 g/mol. Its IUPAC name is 2-[3-[1-[[3-piperazin-1-ylpropyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[1-[[3-piperazin-1-ylpropyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59176455 |
| Molecular Formula | C39H43N7O2 |
| Molecular Weight | 641.82 g/mol |
| Exact Mass | 641.35 |
| IUPAC Name | 2-[3-[1-[[3-piperazin-1-ylpropyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCn1c2ccccc2c2ccnc(CN(CCCN3CCNCC3)[C@H]3CCCc4cccnc43)c21 |
| InChI | InChI=1S/C39H43N7O2/c47-38-31-12-1-2-13-32(31)39(48)46(38)24-8-23-45-34-14-4-3-11-29(34)30-16-18-41-33(37(30)45)27-44(22-7-21-43-25-19-40-20-26-43)35-15-5-9-28-10-6-17-42-36(28)35/h1-4,6,10-14,16-18,35,40H,5,7-9,15,19-27H2/t35-/m0/s1 |
| InChIKey | KZNPSFOFSKDWBF-DHUJRADRSA-N |
| XLogP | 5.45 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.82 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|