C32H40N6O2 — CID 59176456
2-[1-[[4-aminobutyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]-N-(oxan-4-yl)acetamide (PubChem CID 59176456) has the molecular formula C32H40N6O2 and a molecular weight of 540.71 g/mol. Its IUPAC name is 2-[1-[[4-aminobutyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]-N-(oxan-4-yl)acetamide.
| Compound Name | 2-[1-[[4-aminobutyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 59176456 |
| Molecular Formula | C32H40N6O2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | 2-[1-[[4-aminobutyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]-N-(oxan-4-yl)acetamide |
| SMILES | NCCCCN(Cc1nccc2c3ccccc3n(CC(=O)NC3CCOCC3)c12)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C32H40N6O2/c33-15-3-4-18-37(29-11-5-7-23-8-6-16-35-31(23)29)21-27-32-26(12-17-34-27)25-9-1-2-10-28(25)38(32)22-30(39)36-24-13-19-40-20-14-24/h1-2,6,8-10,12,16-17,24,29H,3-5,7,11,13-15,18-22,33H2,(H,36,39)/t29-/m0/s1 |
| InChIKey | QQAXZKBDEDJOOC-LJAQVGFWSA-N |
| XLogP | 4.50 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|