C32H29N5O2 — CID 59176593
2-[2-[1-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]ethyl]isoindole-1,3-dione (PubChem CID 59176593) has the molecular formula C32H29N5O2 and a molecular weight of 515.62 g/mol. Its IUPAC name is 2-[2-[1-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[1-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59176593 |
| Molecular Formula | C32H29N5O2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-[2-[1-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]ethyl]isoindole-1,3-dione |
| SMILES | CN(Cc1nccc2c3ccccc3n(CCN3C(=O)c4ccccc4C3=O)c12)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C32H29N5O2/c1-35(28-14-6-8-21-9-7-16-34-29(21)28)20-26-30-23(15-17-33-26)22-10-4-5-13-27(22)36(30)18-19-37-31(38)24-11-2-3-12-25(24)32(37)39/h2-5,7,9-13,15-17,28H,6,8,14,18-20H2,1H3/t28-/m0/s1 |
| InChIKey | GJIDOKDKTJPHIP-NDEPHWFRSA-N |
| XLogP | 5.39 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|