C15H20Cl2N2 — CID 59176743
2,3-ditert-butyl-6,7-dichloroimidazo[1,2-a]pyridine (PubChem CID 59176743) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 2,3-ditert-butyl-6,7-dichloroimidazo[1,2-a]pyridine.
| Compound Name | 2,3-ditert-butyl-6,7-dichloroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 59176743 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2,3-ditert-butyl-6,7-dichloroimidazo[1,2-a]pyridine |
| SMILES | CC(C)(C)c1nc2cc(Cl)c(Cl)cn2c1C(C)(C)C |
| InChI | InChI=1S/C15H20Cl2N2/c1-14(2,3)12-13(15(4,5)6)19-8-10(17)9(16)7-11(19)18-12/h7-8H,1-6H3 |
| InChIKey | HHILDGMNOAHVSX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |