C25H26N6O4 — CID 59176891
4-[[4-(8-methoxy-2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]-N-(oxan-2-yloxy)benzamide (PubChem CID 59176891) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 4-[[4-(8-methoxy-2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]-N-(oxan-2-yloxy)benzamide.
| Compound Name | 4-[[4-(8-methoxy-2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]-N-(oxan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 59176891 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4-[[4-(8-methoxy-2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]-N-(oxan-2-yloxy)benzamide |
| SMILES | COc1cccn2c(-c3ccnc(Nc4ccc(C(=O)NOC5CCCCO5)cc4)n3)c(C)nc12 |
| InChI | InChI=1S/C25H26N6O4/c1-16-22(31-14-5-6-20(33-2)23(31)27-16)19-12-13-26-25(29-19)28-18-10-8-17(9-11-18)24(32)30-35-21-7-3-4-15-34-21/h5-6,8-14,21H,3-4,7,15H2,1-2H3,(H,30,32)(H,26,28,29) |
| InChIKey | YCILCSKQCPLGMG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|