About 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid
3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid (PubChem CID 59176893) has the molecular formula C18H13N5O2
and a molecular weight of 331.34 g/mol. Its IUPAC name is 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid.
Molecular Properties
| Compound Name | 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid |
| PubChem CID | 59176893 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2nccc(-c3cnc4ccccn34)n2)c1 |
| InChI | InChI=1S/C18H13N5O2/c24-17(25)12-4-3-5-13(10-12)21-18-19-8-7-14(22-18)15-11-20-16-6-1-2-9-23(15)16/h1-11H,(H,24,25)(H,19,21,22) |
| InChIKey | VNAMNSSXBAKTCA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid?
The IUPAC name of 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid (CID 59176893) is 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid.
What is the SMILES notation for 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid?
The canonical SMILES for 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid is O=C(O)c1cccc(Nc2nccc(-c3cnc4ccccn34)n2)c1.
What is the InChIKey of 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid?
The InChIKey is VNAMNSSXBAKTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N5O2/c24-17(25)12-4-3-5-13(10-12)21-18-19-8-7-14(22-18)15-11-20-16-6-1-2-9-23(15)16/h1-11H,(H,24,25)(H,19,21,22).
What are the key properties of 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid?
3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid has a molecular weight of 331.34 g/mol, XLogP of 3.23, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzoic acid is sourced from PubChem (CID 59176893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).