C17H14N6O2S — CID 59176933
N-hydroxy-2-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 59176933) has the molecular formula C17H14N6O2S and a molecular weight of 366.41 g/mol. Its IUPAC name is N-hydroxy-2-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-hydroxy-2-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 59176933 |
| Molecular Formula | C17H14N6O2S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-hydroxy-2-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc2ccccn2c1-c1ccnc(Nc2ncc(C(=O)NO)s2)c1 |
| InChI | InChI=1S/C17H14N6O2S/c1-10-15(23-7-3-2-4-14(23)20-10)11-5-6-18-13(8-11)21-17-19-9-12(26-17)16(24)22-25/h2-9,25H,1H3,(H,22,24)(H,18,19,21) |
| InChIKey | XACOQRYSGNXKMX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|