C17H17Cl2N3O2S — CID 59177212
4-chloro-N-[(1R)-1-(7-chloro-1-ethylbenzimidazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 59177212) has the molecular formula C17H17Cl2N3O2S and a molecular weight of 398.32 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-1-(7-chloro-1-ethylbenzimidazol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(1R)-1-(7-chloro-1-ethylbenzimidazol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59177212 |
| Molecular Formula | C17H17Cl2N3O2S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 4-chloro-N-[(1R)-1-(7-chloro-1-ethylbenzimidazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | CCn1c([C@@H](C)NS(=O)(=O)c2ccc(Cl)cc2)nc2cccc(Cl)c21 |
| InChI | InChI=1S/C17H17Cl2N3O2S/c1-3-22-16-14(19)5-4-6-15(16)20-17(22)11(2)21-25(23,24)13-9-7-12(18)8-10-13/h4-11,21H,3H2,1-2H3/t11-/m1/s1 |
| InChIKey | FLYXTTPNIGWWKY-LLVKDONJSA-N |
| XLogP | 4.40 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |