About methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate
methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate (PubChem CID 591773) has the molecular formula C10H10O5
and a molecular weight of 210.18 g/mol. Its IUPAC name is methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate.
Molecular Properties
| Compound Name | methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate |
| PubChem CID | 591773 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate |
| SMILES | COC(=O)c1c(C)cc(O)c(C=O)c1O |
| InChI | InChI=1S/C10H10O5/c1-5-3-7(12)6(4-11)9(13)8(5)10(14)15-2/h3-4,12-13H,1-2H3 |
| InChIKey | PXFMUVDLJWXOQM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate?
The IUPAC name of methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate (CID 591773) is methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate.
What is the SMILES notation for methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate?
The canonical SMILES for methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate is COC(=O)c1c(C)cc(O)c(C=O)c1O.
What is the InChIKey of methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate?
The InChIKey is PXFMUVDLJWXOQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5/c1-5-3-7(12)6(4-11)9(13)8(5)10(14)15-2/h3-4,12-13H,1-2H3.
What are the key properties of methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate?
methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate has a molecular weight of 210.18 g/mol, XLogP of 1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-formyl-2,4-dihydroxy-6-methylbenzoate is sourced from PubChem (CID 591773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).