About [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate
[4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate (PubChem CID 59177314) has the molecular formula C28H25F3N2O3
and a molecular weight of 494.51 g/mol. Its IUPAC name is [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate.
Molecular Properties
| Compound Name | [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate |
| PubChem CID | 59177314 |
| Molecular Formula | C28H25F3N2O3 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate |
| SMILES | O=C(CCN1CCCCC1)Oc1ccc(C2(c3ccc(F)cc3)C(=O)Nc3c2ccc(F)c3F)cc1 |
| InChI | InChI=1S/C28H25F3N2O3/c29-20-8-4-18(5-9-20)28(22-12-13-23(30)25(31)26(22)32-27(28)35)19-6-10-21(11-7-19)36-24(34)14-17-33-15-2-1-3-16-33/h4-13H,1-3,14-17H2,(H,32,35) |
| InChIKey | OBVQKUJXGDVIGI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate?
The IUPAC name of [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate (CID 59177314) is [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate.
What is the SMILES notation for [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate?
The canonical SMILES for [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate is O=C(CCN1CCCCC1)Oc1ccc(C2(c3ccc(F)cc3)C(=O)Nc3c2ccc(F)c3F)cc1.
What is the InChIKey of [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate?
The InChIKey is OBVQKUJXGDVIGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25F3N2O3/c29-20-8-4-18(5-9-20)28(22-12-13-23(30)25(31)26(22)32-27(28)35)19-6-10-21(11-7-19)36-24(34)14-17-33-15-2-1-3-16-33/h4-13H,1-3,14-17H2,(H,32,35).
What are the key properties of [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate?
[4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate has a molecular weight of 494.51 g/mol, XLogP of 5.17, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[6,7-difluoro-3-(4-fluorophenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-piperidin-1-ylpropanoate is sourced from PubChem (CID 59177314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).