About 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate
1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 59177402) has the molecular formula C25H29NO5
and a molecular weight of 423.51 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| PubChem CID | 59177402 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | COC(=O)C1=C(c2cccc(-c3ccccc3)c2)C(OC)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C25H29NO5/c1-25(2,3)31-24(28)26-15-20(23(27)30-5)22(21(16-26)29-4)19-13-9-12-18(14-19)17-10-7-6-8-11-17/h6-14,21H,15-16H2,1-5H3 |
| InChIKey | ZGVBPEXZUBXDQV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (CID 59177402) is 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate is COC(=O)C1=C(c2cccc(-c3ccccc3)c2)C(OC)CN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The InChIKey is ZGVBPEXZUBXDQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NO5/c1-25(2,3)31-24(28)26-15-20(23(27)30-5)22(21(16-26)29-4)19-13-9-12-18(14-19)17-10-7-6-8-11-17/h6-14,21H,15-16H2,1-5H3.
What are the key properties of 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate has a molecular weight of 423.51 g/mol, XLogP of 4.55, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-methyl 3-methoxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate is sourced from PubChem (CID 59177402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).