About 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate
1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 59177621) has the molecular formula C24H27NO5
and a molecular weight of 409.48 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| PubChem CID | 59177621 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | COC(=O)C1=C(c2cccc(-c3ccccc3)c2)C(O)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H27NO5/c1-24(2,3)30-23(28)25-14-19(22(27)29-4)21(20(26)15-25)18-12-8-11-17(13-18)16-9-6-5-7-10-16/h5-13,20,26H,14-15H2,1-4H3 |
| InChIKey | FEBBFJLLXPAWKG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (CID 59177621) is 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate is COC(=O)C1=C(c2cccc(-c3ccccc3)c2)C(O)CN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The InChIKey is FEBBFJLLXPAWKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO5/c1-24(2,3)30-23(28)25-14-19(22(27)29-4)21(20(26)15-25)18-12-8-11-17(13-18)16-9-6-5-7-10-16/h5-13,20,26H,14-15H2,1-4H3.
What are the key properties of 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate has a molecular weight of 409.48 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-methyl 3-hydroxy-4-(3-phenylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate is sourced from PubChem (CID 59177621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).