C15H25BN2O4S — CID 59177715
tert-butyl N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate (PubChem CID 59177715) has the molecular formula C15H25BN2O4S and a molecular weight of 340.25 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 59177715 |
| Molecular Formula | C15H25BN2O4S |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | tert-butyl N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ncc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C15H25BN2O4S/c1-13(2,3)20-12(19)18(8)11-17-9-10(23-11)16-21-14(4,5)15(6,7)22-16/h9H,1-8H3 |
| InChIKey | QKKFFOJVLPQEEQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|