C14H23N3O7 — CID 59178161
[(1R,2S)-2-nitrooxy-4-(4-propan-2-ylpiperidine-1-carbonyl)cyclopentyl] nitrate (PubChem CID 59178161) has the molecular formula C14H23N3O7 and a molecular weight of 345.35 g/mol. Its IUPAC name is [(1R,2S)-2-nitrooxy-4-(4-propan-2-ylpiperidine-1-carbonyl)cyclopentyl] nitrate.
| Compound Name | [(1R,2S)-2-nitrooxy-4-(4-propan-2-ylpiperidine-1-carbonyl)cyclopentyl] nitrate |
|---|---|
| PubChem CID | 59178161 |
| Molecular Formula | C14H23N3O7 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | [(1R,2S)-2-nitrooxy-4-(4-propan-2-ylpiperidine-1-carbonyl)cyclopentyl] nitrate |
| SMILES | CC(C)C1CCN(C(=O)C2C[C@H](O[N+](=O)[O-])[C@H](O[N+](=O)[O-])C2)CC1 |
| InChI | InChI=1S/C14H23N3O7/c1-9(2)10-3-5-15(6-4-10)14(18)11-7-12(23-16(19)20)13(8-11)24-17(21)22/h9-13H,3-8H2,1-2H3/t11?,12-,13+ |
| InChIKey | KKWIIKLZXNOUTA-YHWZYXNKSA-N |
| XLogP | 1.44 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|