C10H13NO9 — CID 59178217
4-[[(3S,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid (PubChem CID 59178217) has the molecular formula C10H13NO9 and a molecular weight of 291.21 g/mol. Its IUPAC name is 4-[[(3S,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(3S,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59178217 |
| Molecular Formula | C10H13NO9 |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 4-[[(3S,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2O[N+](=O)[O-] |
| InChI | InChI=1S/C10H13NO9/c12-7(13)1-2-8(14)19-5-3-17-10-6(20-11(15)16)4-18-9(5)10/h5-6,9-10H,1-4H2,(H,12,13)/t5-,6-,9+,10+/m0/s1 |
| InChIKey | TYXQMWCGQRQQKG-DWAQLAQLSA-N |
| XLogP | -0.86 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|