About N-cyclohexyl-1,3-benzothiazol-2-amine
N-cyclohexyl-1,3-benzothiazol-2-amine (PubChem CID 591790) has the molecular formula C13H16N2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is N-cyclohexyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-1,3-benzothiazol-2-amine |
| PubChem CID | 591790 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-cyclohexyl-1,3-benzothiazol-2-amine |
| SMILES | c1ccc2sc(NC3CCCCC3)nc2c1 |
| InChI | InChI=1S/C13H16N2S/c1-2-6-10(7-3-1)14-13-15-11-8-4-5-9-12(11)16-13/h4-5,8-10H,1-3,6-7H2,(H,14,15) |
| InChIKey | UPWPIFMHSFSVLE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-1,3-benzothiazol-2-amine?
The IUPAC name of N-cyclohexyl-1,3-benzothiazol-2-amine (CID 591790) is N-cyclohexyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-cyclohexyl-1,3-benzothiazol-2-amine?
The canonical SMILES for N-cyclohexyl-1,3-benzothiazol-2-amine is c1ccc2sc(NC3CCCCC3)nc2c1.
What is the InChIKey of N-cyclohexyl-1,3-benzothiazol-2-amine?
The InChIKey is UPWPIFMHSFSVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2S/c1-2-6-10(7-3-1)14-13-15-11-8-4-5-9-12(11)16-13/h4-5,8-10H,1-3,6-7H2,(H,14,15).
What are the key properties of N-cyclohexyl-1,3-benzothiazol-2-amine?
N-cyclohexyl-1,3-benzothiazol-2-amine has a molecular weight of 232.35 g/mol, XLogP of 4.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 591790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).