About 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid
2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 59179265) has the molecular formula C19H12BrN3O2S
and a molecular weight of 426.30 g/mol. Its IUPAC name is 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 59179265 |
| Molecular Formula | C19H12BrN3O2S |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-n2nc(-c3ccccc3)c(Br)c2-c2ccccc2)n1 |
| InChI | InChI=1S/C19H12BrN3O2S/c20-15-16(12-7-3-1-4-8-12)22-23(17(15)13-9-5-2-6-10-13)19-21-14(11-26-19)18(24)25/h1-11H,(H,24,25) |
| InChIKey | FVFTZHBEOKHLHA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid (CID 59179265) is 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(-n2nc(-c3ccccc3)c(Br)c2-c2ccccc2)n1.
What is the InChIKey of 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is FVFTZHBEOKHLHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12BrN3O2S/c20-15-16(12-7-3-1-4-8-12)22-23(17(15)13-9-5-2-6-10-13)19-21-14(11-26-19)18(24)25/h1-11H,(H,24,25).
What are the key properties of 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid?
2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 426.30 g/mol, XLogP of 5.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 59179265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).