About (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene
(1R)-1-azido-5-bromo-2,3-dihydro-1H-indene (PubChem CID 59179602) has the molecular formula C9H8BrN3
and a molecular weight of 238.09 g/mol. Its IUPAC name is (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene |
| PubChem CID | 59179602 |
| Molecular Formula | C9H8BrN3 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene |
| SMILES | [N-]=[N+]=N[C@@H]1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C9H8BrN3/c10-7-2-3-8-6(5-7)1-4-9(8)12-13-11/h2-3,5,9H,1,4H2/t9-/m1/s1 |
| InChIKey | AIGQUTBPGLMZRZ-SECBINFHSA-N |
| XLogP | 3.75 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene?
The IUPAC name of (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene (CID 59179602) is (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene.
What is the SMILES notation for (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene?
The canonical SMILES for (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene is [N-]=[N+]=N[C@@H]1CCc2cc(Br)ccc21.
What is the InChIKey of (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene?
The InChIKey is AIGQUTBPGLMZRZ-SECBINFHSA-N. The full InChI is InChI=1S/C9H8BrN3/c10-7-2-3-8-6(5-7)1-4-9(8)12-13-11/h2-3,5,9H,1,4H2/t9-/m1/s1.
What are the key properties of (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene?
(1R)-1-azido-5-bromo-2,3-dihydro-1H-indene has a molecular weight of 238.09 g/mol, XLogP of 3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-azido-5-bromo-2,3-dihydro-1H-indene is sourced from PubChem (CID 59179602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).