C24H32N4O4S — CID 59179850
(5R,8S,11S)-5-methyl-11-[(E)-pent-1-enyl]-8-propan-2-yl-10-oxa-3-thia-7,14,20,21-tetrazatricyclo[14.3.1.12,5]henicosa-1(19),2(21),16(20),17-tetraene-6,9,13-trione (PubChem CID 59179850) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is (5R,8S,11S)-5-methyl-11-[(E)-pent-1-enyl]-8-propan-2-yl-10-oxa-3-thia-7,14,20,21-tetrazatricyclo[14.3.1.12,5]henicosa-1(19),2(21),16(20),17-tetraene-6,9,13-trione.
| Compound Name | (5R,8S,11S)-5-methyl-11-[(E)-pent-1-enyl]-8-propan-2-yl-10-oxa-3-thia-7,14,20,21-tetrazatricyclo[14.3.1.12,5]henicosa-1(19),2(21),16(20),17-tetraene-6,9,13-trione |
|---|---|
| PubChem CID | 59179850 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | (5R,8S,11S)-5-methyl-11-[(E)-pent-1-enyl]-8-propan-2-yl-10-oxa-3-thia-7,14,20,21-tetrazatricyclo[14.3.1.12,5]henicosa-1(19),2(21),16(20),17-tetraene-6,9,13-trione |
| SMILES | CCC/C=C/[C@@H]1CC(=O)NCc2cccc(n2)C2=N[C@@](C)(CS2)C(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C24H32N4O4S/c1-5-6-7-10-17-12-19(29)25-13-16-9-8-11-18(26-16)21-28-24(4,14-33-21)23(31)27-20(15(2)3)22(30)32-17/h7-11,15,17,20H,5-6,12-14H2,1-4H3,(H,25,29)(H,27,31)/b10-7+/t17-,20+,24+/m1/s1 |
| InChIKey | PSWIGQVLQDOHJI-UANRCOHXSA-N |
| XLogP | 2.76 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|