C12H23N — CID 59179868
2,2-dimethyl-N-[(Z)-2,3,3-trimethylbut-1-enyl]propan-1-imine (PubChem CID 59179868) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(Z)-2,3,3-trimethylbut-1-enyl]propan-1-imine.
| Compound Name | 2,2-dimethyl-N-[(Z)-2,3,3-trimethylbut-1-enyl]propan-1-imine |
|---|---|
| PubChem CID | 59179868 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 2,2-dimethyl-N-[(Z)-2,3,3-trimethylbut-1-enyl]propan-1-imine |
| SMILES | C/C(=C/N=C/C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H23N/c1-10(12(5,6)7)8-13-9-11(2,3)4/h8-9H,1-7H3/b10-8-,13-9+ |
| InChIKey | REZLJYXBFJUFSN-KKCPJAHZSA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|