About [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate
[2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate (PubChem CID 59179916) has the molecular formula C18H14N4O2S2
and a molecular weight of 382.47 g/mol. Its IUPAC name is [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate.
Molecular Properties
| Compound Name | [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate |
| PubChem CID | 59179916 |
| Molecular Formula | C18H14N4O2S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate |
| SMILES | CCSc1ccc2c(-c3ccccc3)nn(-c3nc(OC=O)cs3)c2n1 |
| InChI | InChI=1S/C18H14N4O2S2/c1-2-25-15-9-8-13-16(12-6-4-3-5-7-12)21-22(17(13)20-15)18-19-14(10-26-18)24-11-23/h3-11H,2H2,1H3 |
| InChIKey | KTAFAZDIOQREED-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
The IUPAC name of [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate (CID 59179916) is [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate.
What is the SMILES notation for [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
The canonical SMILES for [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate is CCSc1ccc2c(-c3ccccc3)nn(-c3nc(OC=O)cs3)c2n1.
What is the InChIKey of [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
The InChIKey is KTAFAZDIOQREED-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O2S2/c1-2-25-15-9-8-13-16(12-6-4-3-5-7-12)21-22(17(13)20-15)18-19-14(10-26-18)24-11-23/h3-11H,2H2,1H3.
What are the key properties of [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
[2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate has a molecular weight of 382.47 g/mol, XLogP of 4.19, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6-ethylsulfanyl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate is sourced from PubChem (CID 59179916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).