About [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate
[2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate (PubChem CID 59179962) has the molecular formula C16H10N4O2S
and a molecular weight of 322.35 g/mol. Its IUPAC name is [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate.
Molecular Properties
| Compound Name | [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate |
| PubChem CID | 59179962 |
| Molecular Formula | C16H10N4O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate |
| SMILES | O=COc1csc(-n2nc(-c3ccccc3)c3cnccc32)n1 |
| InChI | InChI=1S/C16H10N4O2S/c21-10-22-14-9-23-16(18-14)20-13-6-7-17-8-12(13)15(19-20)11-4-2-1-3-5-11/h1-10H |
| InChIKey | ZCWKCZFLERFFAN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
The IUPAC name of [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate (CID 59179962) is [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate.
What is the SMILES notation for [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
The canonical SMILES for [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate is O=COc1csc(-n2nc(-c3ccccc3)c3cnccc32)n1.
What is the InChIKey of [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
The InChIKey is ZCWKCZFLERFFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4O2S/c21-10-22-14-9-23-16(18-14)20-13-6-7-17-8-12(13)15(19-20)11-4-2-1-3-5-11/h1-10H.
What are the key properties of [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate?
[2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate has a molecular weight of 322.35 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-phenylpyrazolo[4,3-c]pyridin-1-yl)-1,3-thiazol-4-yl] formate is sourced from PubChem (CID 59179962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).