About 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid
2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 59179967) has the molecular formula C16H10N4O2S
and a molecular weight of 322.35 g/mol. Its IUPAC name is 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 59179967 |
| Molecular Formula | C16H10N4O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-n2nc(-c3ccccc3)c3ccncc32)n1 |
| InChI | InChI=1S/C16H10N4O2S/c21-15(22)12-9-23-16(18-12)20-13-8-17-7-6-11(13)14(19-20)10-4-2-1-3-5-10/h1-9H,(H,21,22) |
| InChIKey | VGOASTCNSKMLTL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid (CID 59179967) is 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(-n2nc(-c3ccccc3)c3ccncc32)n1.
What is the InChIKey of 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is VGOASTCNSKMLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4O2S/c21-15(22)12-9-23-16(18-12)20-13-8-17-7-6-11(13)14(19-20)10-4-2-1-3-5-10/h1-9H,(H,21,22).
What are the key properties of 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid?
2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 322.35 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-phenylpyrazolo[5,4-c]pyridin-1-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 59179967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).