About 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid
2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 59179998) has the molecular formula C18H14N4O4S
and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 59179998 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | COc1ccc(-c2nn(-c3nc(C(=O)O)cs3)c3ccccc23)c(OC)n1 |
| InChI | InChI=1S/C18H14N4O4S/c1-25-14-8-7-11(16(20-14)26-2)15-10-5-3-4-6-13(10)22(21-15)18-19-12(9-27-18)17(23)24/h3-9H,1-2H3,(H,23,24) |
| InChIKey | DAWCWQRNAPFHFW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid (CID 59179998) is 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid is COc1ccc(-c2nn(-c3nc(C(=O)O)cs3)c3ccccc23)c(OC)n1.
What is the InChIKey of 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is DAWCWQRNAPFHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O4S/c1-25-14-8-7-11(16(20-14)26-2)15-10-5-3-4-6-13(10)22(21-15)18-19-12(9-27-18)17(23)24/h3-9H,1-2H3,(H,23,24).
What are the key properties of 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid?
2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 382.40 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,6-dimethoxy-3-pyridinyl)indazol-1-yl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 59179998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).