About pyridine-3,4-diamine
pyridine-3,4-diamine (PubChem CID 5918) has the molecular formula C5H7N3
and a molecular weight of 109.13 g/mol. Its IUPAC name is pyridine-3,4-diamine.
Molecular Properties
| Compound Name | pyridine-3,4-diamine |
| PubChem CID | 5918 |
| Molecular Formula | C5H7N3 |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.06 |
| IUPAC Name | pyridine-3,4-diamine |
| SMILES | Nc1ccncc1N |
| InChI | InChI=1S/C5H7N3/c6-4-1-2-8-3-5(4)7/h1-3H,7H2,(H2,6,8) |
| InChIKey | OYTKINVCDFNREN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-3,4-diamine?
The IUPAC name of pyridine-3,4-diamine (CID 5918) is pyridine-3,4-diamine.
What is the SMILES notation for pyridine-3,4-diamine?
The canonical SMILES for pyridine-3,4-diamine is Nc1ccncc1N.
What is the InChIKey of pyridine-3,4-diamine?
The InChIKey is OYTKINVCDFNREN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3/c6-4-1-2-8-3-5(4)7/h1-3H,7H2,(H2,6,8).
What are the key properties of pyridine-3,4-diamine?
pyridine-3,4-diamine has a molecular weight of 109.13 g/mol, XLogP of 0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-3,4-diamine is sourced from PubChem (CID 5918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).