methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate

C11H19NO2 — CID 59180255

IUPACmethyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate
SMILESCOC(=O)[C@H](CC(C)C)N1CC=CC1
InChIInChI=1S/C11H19NO2/c1-9(2)8-10(11(13)14-3)12-6-4-5-7-12/h4-5,9-10H,6-8H2,1-3H3/t10-/m0/s1
InChIKeyBYSVSIMAVZFANQ-JTQLQIEISA-N
MW197.28 g/mol
LogP1.45
Rot. Bonds4

About methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate

methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate (PubChem CID 59180255) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate.

Molecular Properties

Compound Namemethyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate
PubChem CID59180255
Molecular FormulaC11H19NO2
Molecular Weight197.28 g/mol
Exact Mass197.14
IUPAC Namemethyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate
SMILESCOC(=O)[C@H](CC(C)C)N1CC=CC1
InChIInChI=1S/C11H19NO2/c1-9(2)8-10(11(13)14-3)12-6-4-5-7-12/h4-5,9-10H,6-8H2,1-3H3/t10-/m0/s1
InChIKeyBYSVSIMAVZFANQ-JTQLQIEISA-N
XLogP1.45
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.28
LogP ≤ 51.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate?
The IUPAC name of methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate (CID 59180255) is methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate.
What is the SMILES notation for methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate?
The canonical SMILES for methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate is COC(=O)[C@H](CC(C)C)N1CC=CC1.
What is the InChIKey of methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate?
The InChIKey is BYSVSIMAVZFANQ-JTQLQIEISA-N. The full InChI is InChI=1S/C11H19NO2/c1-9(2)8-10(11(13)14-3)12-6-4-5-7-12/h4-5,9-10H,6-8H2,1-3H3/t10-/m0/s1.
What are the key properties of methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate?
methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate has a molecular weight of 197.28 g/mol, XLogP of 1.45, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(2,5-dihydropyrrol-1-yl)-4-methylpentanoate is sourced from PubChem (CID 59180255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).