C14H11Cl2NO4 — CID 59180290
ethyl (1R,5R)-1-(3,4-dichlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 59180290) has the molecular formula C14H11Cl2NO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is ethyl (1R,5R)-1-(3,4-dichlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethyl (1R,5R)-1-(3,4-dichlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 59180290 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | ethyl (1R,5R)-1-(3,4-dichlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CCOC(=O)C1[C@H]2C(=O)NC(=O)[C@@]12c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2NO4/c1-2-21-12(19)10-9-11(18)17-13(20)14(9,10)6-3-4-7(15)8(16)5-6/h3-5,9-10H,2H2,1H3,(H,17,18,20)/t9-,10?,14+/m0/s1 |
| InChIKey | UEWPCUMDQJNJFD-UGJFRGMJSA-N |
| XLogP | 1.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|