About [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane
[dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane (PubChem CID 59180647) has the molecular formula C10H25F3O3Si3
and a molecular weight of 334.56 g/mol. Its IUPAC name is [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane.
Molecular Properties
| Compound Name | [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane |
| PubChem CID | 59180647 |
| Molecular Formula | C10H25F3O3Si3 |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)COCC(F)(F)F |
| InChI | InChI=1S/C10H25F3O3Si3/c1-17(2,3)15-19(6,7)16-18(4,5)9-14-8-10(11,12)13/h8-9H2,1-7H3 |
| InChIKey | SBVYFILYQJCXGD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane?
The IUPAC name of [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane (CID 59180647) is [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane.
What is the SMILES notation for [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane?
The canonical SMILES for [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane is C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)COCC(F)(F)F.
What is the InChIKey of [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane?
The InChIKey is SBVYFILYQJCXGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25F3O3Si3/c1-17(2,3)15-19(6,7)16-18(4,5)9-14-8-10(11,12)13/h8-9H2,1-7H3.
What are the key properties of [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane?
[dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane has a molecular weight of 334.56 g/mol, XLogP of 3.88, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(2,2,2-trifluoroethoxymethyl)silyl]oxy-dimethyl-trimethylsilyloxysilane is sourced from PubChem (CID 59180647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).