C40H36Si2 — CID 59182791
8,8,13,13-tetramethyl-5,16-bis(4-methylphenyl)-8,13-disilahexacyclo[10.10.2.02,7.09,23.014,19.020,24]tetracosa-1(23),2(7),3,5,9,11,14(19),15,17,20(24),21-undecaene (PubChem CID 59182791) has the molecular formula C40H36Si2 and a molecular weight of 572.90 g/mol. Its IUPAC name is 8,8,13,13-tetramethyl-5,16-bis(4-methylphenyl)-8,13-disilahexacyclo[10.10.2.02,7.09,23.014,19.020,24]tetracosa-1(23),2(7),3,5,9,11,14(19),15,17,20(24),21-undecaene.
| Compound Name | 8,8,13,13-tetramethyl-5,16-bis(4-methylphenyl)-8,13-disilahexacyclo[10.10.2.02,7.09,23.014,19.020,24]tetracosa-1(23),2(7),3,5,9,11,14(19),15,17,20(24),21-undecaene |
|---|---|
| PubChem CID | 59182791 |
| Molecular Formula | C40H36Si2 |
| Molecular Weight | 572.90 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 8,8,13,13-tetramethyl-5,16-bis(4-methylphenyl)-8,13-disilahexacyclo[10.10.2.02,7.09,23.014,19.020,24]tetracosa-1(23),2(7),3,5,9,11,14(19),15,17,20(24),21-undecaene |
| SMILES | Cc1ccc(-c2ccc3c(c2)[Si](C)(C)c2ccc4c5c(ccc-3c25)-c2ccc(-c3ccc(C)cc3)cc2[Si]4(C)C)cc1 |
| InChI | InChI=1S/C40H36Si2/c1-25-7-11-27(12-8-25)29-15-17-31-33-19-20-34-32-18-16-30(28-13-9-26(2)10-14-28)24-38(32)42(5,6)36-22-21-35(39(33)40(34)36)41(3,4)37(31)23-29/h7-24H,1-6H3 |
| InChIKey | KPBKGZFYOXVULX-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.90 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|