About 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine
7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine (PubChem CID 59183179) has the molecular formula C45H27N9
and a molecular weight of 693.77 g/mol. Its IUPAC name is 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine.
Molecular Properties
| Compound Name | 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine |
| PubChem CID | 59183179 |
| Molecular Formula | C45H27N9 |
| Molecular Weight | 693.77 g/mol |
| Exact Mass | 693.24 |
| IUPAC Name | 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine |
| SMILES | c1ccc2c(c1)ncc1c(-c3cc(-c4ccncc4)nc(-c4ccncc4)n3)c3ccccc3c(-c3cc(-c4ccncc4)nc(-c4ccncc4)n3)c12 |
| InChI | InChI=1S/C45H27N9/c1-2-6-33-32(5-1)41(39-25-37(28-9-17-46-18-10-28)51-44(53-39)30-13-21-48-22-14-30)35-27-50-36-8-4-3-7-34(36)42(35)43(33)40-26-38(29-11-19-47-20-12-29)52-45(54-40)31-15-23-49-24-16-31/h1-27H |
| InChIKey | GOEHANYDZIRJOG-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 693.77 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine?
The IUPAC name of 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine (CID 59183179) is 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine.
What is the SMILES notation for 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine?
The canonical SMILES for 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine is c1ccc2c(c1)ncc1c(-c3cc(-c4ccncc4)nc(-c4ccncc4)n3)c3ccccc3c(-c3cc(-c4ccncc4)nc(-c4ccncc4)n3)c12.
What is the InChIKey of 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine?
The InChIKey is GOEHANYDZIRJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H27N9/c1-2-6-33-32(5-1)41(39-25-37(28-9-17-46-18-10-28)51-44(53-39)30-13-21-48-22-14-30)35-27-50-36-8-4-3-7-34(36)42(35)43(33)40-26-38(29-11-19-47-20-12-29)52-45(54-40)31-15-23-49-24-16-31/h1-27H.
What are the key properties of 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine?
7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine has a molecular weight of 693.77 g/mol, XLogP of 9.70, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 7,12-bis(2,6-dipyridin-4-ylpyrimidin-4-yl)benzo[j]phenanthridine is sourced from PubChem (CID 59183179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).