C29H20F6IrNO2- — CID 59183436
5,5-dimethyl-3-(1H-naphthalen-1-id-2-yl)indeno[1,2-c]pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59183436) has the molecular formula C29H20F6IrNO2- and a molecular weight of 720.69 g/mol. Its IUPAC name is 5,5-dimethyl-3-(1H-naphthalen-1-id-2-yl)indeno[1,2-c]pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 5,5-dimethyl-3-(1H-naphthalen-1-id-2-yl)indeno[1,2-c]pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59183436 |
| Molecular Formula | C29H20F6IrNO2- |
| Molecular Weight | 720.69 g/mol |
| Exact Mass | 721.10 |
| IUPAC Name | 5,5-dimethyl-3-(1H-naphthalen-1-id-2-yl)indeno[1,2-c]pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC1(C)c2ccccc2-c2cnc(-c3[c-]c4ccccc4cc3)cc21.O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C24H18N.C5H2F6O2.Ir/c1-24(2)21-10-6-5-9-19(21)20-15-25-23(14-22(20)24)18-12-11-16-7-3-4-8-17(16)13-18;6-4(7,8)2(12)1-3(13)5(9,10)11;/h3-12,14-15H,1-2H3;1,12H;/q-1;;/b;2-1-; |
| InChIKey | QFYBHYXIAKGTGA-FJOGWHKWSA-N |
| XLogP | 8.13 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.69 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|