C51H49NSi2 — CID 59183453
5,10-bis(5,5-dimethylspiro[benzo[b][1]benzosiline-10,1'-cyclopentane]-3-yl)benzo[g]quinoline (PubChem CID 59183453) has the molecular formula C51H49NSi2 and a molecular weight of 732.13 g/mol. Its IUPAC name is 5,10-bis(5,5-dimethylspiro[benzo[b][1]benzosiline-10,1'-cyclopentane]-3-yl)benzo[g]quinoline.
| Compound Name | 5,10-bis(5,5-dimethylspiro[benzo[b][1]benzosiline-10,1'-cyclopentane]-3-yl)benzo[g]quinoline |
|---|---|
| PubChem CID | 59183453 |
| Molecular Formula | C51H49NSi2 |
| Molecular Weight | 732.13 g/mol |
| Exact Mass | 731.34 |
| IUPAC Name | 5,10-bis(5,5-dimethylspiro[benzo[b][1]benzosiline-10,1'-cyclopentane]-3-yl)benzo[g]quinoline |
| SMILES | C[Si]1(C)c2ccccc2C2(CCCC2)c2ccc(-c3c4ccccc4c(-c4ccc5c(c4)[Si](C)(C)c4ccccc4C54CCCC4)c4ncccc34)cc21 |
| InChI | InChI=1S/C51H49NSi2/c1-53(2)43-21-9-7-19-39(43)50(27-11-12-28-50)41-25-23-34(32-45(41)53)47-36-16-5-6-17-37(36)48(49-38(47)18-15-31-52-49)35-24-26-42-46(33-35)54(3,4)44-22-10-8-20-40(44)51(42)29-13-14-30-51/h5-10,15-26,31-33H,11-14,27-30H2,1-4H3 |
| InChIKey | LKBIQTLMCFIKEB-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.13 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|