C27H15F6N — CID 59183616
5,10-bis[4-(trifluoromethyl)phenyl]benzo[g]isoquinoline (PubChem CID 59183616) has the molecular formula C27H15F6N and a molecular weight of 467.41 g/mol. Its IUPAC name is 5,10-bis[4-(trifluoromethyl)phenyl]benzo[g]isoquinoline.
| Compound Name | 5,10-bis[4-(trifluoromethyl)phenyl]benzo[g]isoquinoline |
|---|---|
| PubChem CID | 59183616 |
| Molecular Formula | C27H15F6N |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 5,10-bis[4-(trifluoromethyl)phenyl]benzo[g]isoquinoline |
| SMILES | FC(F)(F)c1ccc(-c2c3ccccc3c(-c3ccc(C(F)(F)F)cc3)c3cnccc23)cc1 |
| InChI | InChI=1S/C27H15F6N/c28-26(29,30)18-9-5-16(6-10-18)24-20-3-1-2-4-21(20)25(23-15-34-14-13-22(23)24)17-7-11-19(12-8-17)27(31,32)33/h1-15H |
| InChIKey | SUSOLAPGLYBQOW-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|