About 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten
3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten (PubChem CID 59184641) has the molecular formula C8H9NW2-2
and a molecular weight of 486.85 g/mol. Its IUPAC name is 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten.
Molecular Properties
| Compound Name | 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten |
| PubChem CID | 59184641 |
| Molecular Formula | C8H9NW2-2 |
| Molecular Weight | 486.85 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten |
| SMILES | CC(C)c1[c-]n[c-]cc1.[W].[W] |
| InChI | InChI=1S/C8H9N.2W/c1-7(2)8-4-3-5-9-6-8;;/h3-4,7H,1-2H3;;/q-2;; |
| InChIKey | OYOIJFURPLJRNA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.85 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten?
The IUPAC name of 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten (CID 59184641) is 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten.
What is the SMILES notation for 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten?
The canonical SMILES for 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten is CC(C)c1[c-]n[c-]cc1.[W].[W].
What is the InChIKey of 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten?
The InChIKey is OYOIJFURPLJRNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.2W/c1-7(2)8-4-3-5-9-6-8;;/h3-4,7H,1-2H3;;/q-2;;.
What are the key properties of 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten?
3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten has a molecular weight of 486.85 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-2,6-dihydropyridine-2,6-diide;tungsten is sourced from PubChem (CID 59184641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).