C23H25FN4O3 — CID 59184662
6-(3,5-dimethylbenzoyl)-1-[[2-fluoro-6-(methylamino)-4-pyridinyl]methyl]-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 59184662) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is 6-(3,5-dimethylbenzoyl)-1-[[2-fluoro-6-(methylamino)-4-pyridinyl]methyl]-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 6-(3,5-dimethylbenzoyl)-1-[[2-fluoro-6-(methylamino)-4-pyridinyl]methyl]-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59184662 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 6-(3,5-dimethylbenzoyl)-1-[[2-fluoro-6-(methylamino)-4-pyridinyl]methyl]-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | CNc1cc(Cn2c(C(=O)c3cc(C)cc(C)c3)c(C(C)C)c(=O)[nH]c2=O)cc(F)n1 |
| InChI | InChI=1S/C23H25FN4O3/c1-12(2)19-20(21(29)16-7-13(3)6-14(4)8-16)28(23(31)27-22(19)30)11-15-9-17(24)26-18(10-15)25-5/h6-10,12H,11H2,1-5H3,(H,25,26)(H,27,30,31) |
| InChIKey | BONYNRPVSPCZBJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|