C25H20F2N2O3 — CID 59184970
1'-[(3,4-difluorophenyl)methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 59184970) has the molecular formula C25H20F2N2O3 and a molecular weight of 434.44 g/mol. Its IUPAC name is 1'-[(3,4-difluorophenyl)methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 1'-[(3,4-difluorophenyl)methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 59184970 |
| Molecular Formula | C25H20F2N2O3 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1'-[(3,4-difluorophenyl)methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | CC1(C)c2ccccc2N(Cc2ccc(F)c(F)c2)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C25H20F2N2O3/c1-24(2)19-5-3-4-6-22(19)28(15-16-7-9-20(26)21(27)13-16)25(24)12-11-17-14-18(29(30)31)8-10-23(17)32-25/h3-14H,15H2,1-2H3 |
| InChIKey | GRRQKXPLNIRWLG-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|