C24H46N6O7 — CID 59185327
tert-butyl N-[(2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-[2-(methylamino)ethylamino]-1-oxopentan-2-yl]carbamate (PubChem CID 59185327) has the molecular formula C24H46N6O7 and a molecular weight of 530.67 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-[2-(methylamino)ethylamino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-[2-(methylamino)ethylamino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 59185327 |
| Molecular Formula | C24H46N6O7 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | tert-butyl N-[(2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-[2-(methylamino)ethylamino]-1-oxopentan-2-yl]carbamate |
| SMILES | CNCCNC(=O)[C@H](CCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H46N6O7/c1-22(2,3)35-19(32)28-16(17(31)26-15-14-25-10)12-11-13-27-18(29-20(33)36-23(4,5)6)30-21(34)37-24(7,8)9/h16,25H,11-15H2,1-10H3,(H,26,31)(H,28,32)(H2,27,29,30,33,34)/t16-/m0/s1 |
| InChIKey | ITAAFYXFZDTVKM-INIZCTEOSA-N |
| XLogP | 2.40 |
| TPSA | 168.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|