C12H15FN4O2 — CID 59185408
[(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-methyloxolan-2-yl]methanol (PubChem CID 59185408) has the molecular formula C12H15FN4O2 and a molecular weight of 266.28 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-methyloxolan-2-yl]methanol.
| Compound Name | [(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185408 |
| Molecular Formula | C12H15FN4O2 |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-methyloxolan-2-yl]methanol |
| SMILES | C[C@H]1[C@@H](F)[C@H](c2ccc3c(N)ncnn23)O[C@@H]1CO |
| InChI | InChI=1S/C12H15FN4O2/c1-6-9(4-18)19-11(10(6)13)7-2-3-8-12(14)15-5-16-17(7)8/h2-3,5-6,9-11,18H,4H2,1H3,(H2,14,15,16)/t6-,9-,10-,11+/m1/s1 |
| InChIKey | NBXRMTAGUWDCNP-JBRWXDEYSA-N |
| XLogP | 0.72 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |