C15H17FN4O2 — CID 59185412
[(2R,3S,5R)-5-(4-amino-5-ethynylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol (PubChem CID 59185412) has the molecular formula C15H17FN4O2 and a molecular weight of 304.33 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-5-ethynylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2R,3S,5R)-5-(4-amino-5-ethynylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185412 |
| Molecular Formula | C15H17FN4O2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-5-ethynylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol |
| SMILES | C#Cc1cc([C@@H]2O[C@H](CO)[C@@H](F)C2(C)C)n2ncnc(N)c12 |
| InChI | InChI=1S/C15H17FN4O2/c1-4-8-5-9(20-11(8)14(17)18-7-19-20)13-15(2,3)12(16)10(6-21)22-13/h1,5,7,10,12-13,21H,6H2,2-3H3,(H2,17,18,19)/t10-,12-,13+/m1/s1 |
| InChIKey | HJWJGBHOJFHVCX-RTXFEEFZSA-N |
| XLogP | 1.09 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|