C14H16FN7O2 — CID 59185417
[(2S,3R,4R,5S)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3-methyloxolan-2-yl]methanol (PubChem CID 59185417) has the molecular formula C14H16FN7O2 and a molecular weight of 333.33 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3-methyloxolan-2-yl]methanol.
| Compound Name | [(2S,3R,4R,5S)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185417 |
| Molecular Formula | C14H16FN7O2 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [(2S,3R,4R,5S)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3-methyloxolan-2-yl]methanol |
| SMILES | C[C@H]1[C@@H](F)[C@H](c2cc(-c3cn[nH]n3)c3c(N)ncnn23)O[C@@H]1CO |
| InChI | InChI=1S/C14H16FN7O2/c1-6-10(4-23)24-13(11(6)15)9-2-7(8-3-18-21-20-8)12-14(16)17-5-19-22(9)12/h2-3,5-6,10-11,13,23H,4H2,1H3,(H2,16,17,19)(H,18,20,21)/t6-,10-,11-,13+/m1/s1 |
| InChIKey | HYPPZTQZWASDAJ-VXVOXSTESA-N |
| XLogP | 0.50 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |