C14H16N10O3 — CID 59185418
(2S,3S,4S,5S)-2-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-azido-5-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 59185418) has the molecular formula C14H16N10O3 and a molecular weight of 372.35 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-azido-5-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2S,3S,4S,5S)-2-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-azido-5-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 59185418 |
| Molecular Formula | C14H16N10O3 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (2S,3S,4S,5S)-2-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-azido-5-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C[C@H]1[C@H](O)[C@H](c2cc(-c3cn[nH]n3)c3c(N)ncnn23)O[C@@]1(CO)N=[N+]=[N-] |
| InChI | InChI=1S/C14H16N10O3/c1-6-11(26)12(27-14(6,4-25)21-22-16)9-2-7(8-3-18-23-20-8)10-13(15)17-5-19-24(9)10/h2-3,5-6,11-12,25-26H,4H2,1H3,(H2,15,17,19)(H,18,20,23)/t6-,11-,12-,14+/m0/s1 |
| InChIKey | JZUOJMIPUJRXKG-WNJCLCKLSA-N |
| XLogP | 0.16 |
| TPSA | 196.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|