C18H25FN4O2Si — CID 59185419
[(2S,3R,4R,5S)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3,4-dimethyloxolan-2-yl]methanol (PubChem CID 59185419) has the molecular formula C18H25FN4O2Si and a molecular weight of 376.51 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3,4-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2S,3R,4R,5S)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3,4-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185419 |
| Molecular Formula | C18H25FN4O2Si |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [(2S,3R,4R,5S)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3,4-dimethyloxolan-2-yl]methanol |
| SMILES | C[C@@H]1[C@@H](CO)O[C@@H](c2cc(C#C[Si](C)(C)C)c3c(N)ncnn23)[C@]1(C)F |
| InChI | InChI=1S/C18H25FN4O2Si/c1-11-14(9-24)25-16(18(11,2)19)13-8-12(6-7-26(3,4)5)15-17(20)21-10-22-23(13)15/h8,10-11,14,16,24H,9H2,1-5H3,(H2,20,21,22)/t11-,14-,16+,18-/m1/s1 |
| InChIKey | OEVXLLZLXMPUGP-BKBPNQFYSA-N |
| XLogP | 2.34 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|