C15H17N5O3S — CID 59185437
(2S,3S,4S,5S)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 59185437) has the molecular formula C15H17N5O3S and a molecular weight of 347.40 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2S,3S,4S,5S)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 59185437 |
| Molecular Formula | C15H17N5O3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (2S,3S,4S,5S)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C[C@H]1[C@H](O)[C@H](c2cc(-c3nccs3)c3c(N)ncnn23)O[C@@H]1CO |
| InChI | InChI=1S/C15H17N5O3S/c1-7-10(5-21)23-13(12(7)22)9-4-8(15-17-2-3-24-15)11-14(16)18-6-19-20(9)11/h2-4,6-7,10,12-13,21-22H,5H2,1H3,(H2,16,18,19)/t7-,10-,12+,13+/m1/s1 |
| InChIKey | YHFKAUZETWJYKC-SJFDICSNSA-N |
| XLogP | 0.86 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |